C15H21N5OS — CID 95990634
2,6-dimethyl-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]pyridine-3-carboxamide (PubChem CID 95990634) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 2,6-dimethyl-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dimethyl-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95990634 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2,6-dimethyl-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCn2c(C(C)C)n[nH]c2=S)c(C)n1 |
| InChI | InChI=1S/C15H21N5OS/c1-9(2)13-18-19-15(22)20(13)8-7-16-14(21)12-6-5-10(3)17-11(12)4/h5-6,9H,7-8H2,1-4H3,(H,16,21)(H,19,22) |
| InChIKey | ARTDOVWMXBSXOC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|