C16H18F2N4OS — CID 95935142
(E)-3-(2,6-difluorophenyl)-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]prop-2-enamide (PubChem CID 95935142) has the molecular formula C16H18F2N4OS and a molecular weight of 352.41 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-difluorophenyl)-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 95935142 |
| Molecular Formula | C16H18F2N4OS |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]prop-2-enamide |
| SMILES | CC(C)c1n[nH]c(=S)n1CCNC(=O)/C=C/c1c(F)cccc1F |
| InChI | InChI=1S/C16H18F2N4OS/c1-10(2)15-20-21-16(24)22(15)9-8-19-14(23)7-6-11-12(17)4-3-5-13(11)18/h3-7,10H,8-9H2,1-2H3,(H,19,23)(H,21,24)/b7-6+ |
| InChIKey | PGIUAPCBWJIZFV-VOTSOKGWSA-N |
| XLogP | 3.17 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|