C17H21N5O2S — CID 75533951
(E)-N-[2-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethylamino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 75533951) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is (E)-N-[2-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethylamino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethylamino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 75533951 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (E)-N-[2-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethylamino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | CCc1n[nH]c(=S)n1CCNC(=O)CNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H21N5O2S/c1-2-14-20-21-17(25)22(14)11-10-18-16(24)12-19-15(23)9-8-13-6-4-3-5-7-13/h3-9H,2,10-12H2,1H3,(H,18,24)(H,19,23)(H,21,25)/b9-8+ |
| InChIKey | DATGLLHJSTUSNF-CMDGGOBGSA-N |
| XLogP | 1.45 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|