C16H22N6OS — CID 134068392
N-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-phenylpyrazolidine-4-carboxamide (PubChem CID 134068392) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-phenylpyrazolidine-4-carboxamide.
| Compound Name | N-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-phenylpyrazolidine-4-carboxamide |
|---|---|
| PubChem CID | 134068392 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-phenylpyrazolidine-4-carboxamide |
| SMILES | CCc1n[nH]c(=S)n1CCNC(=O)C1CNNC1c1ccccc1 |
| InChI | InChI=1S/C16H22N6OS/c1-2-13-19-21-16(24)22(13)9-8-17-15(23)12-10-18-20-14(12)11-6-4-3-5-7-11/h3-7,12,14,18,20H,2,8-10H2,1H3,(H,17,23)(H,21,24) |
| InChIKey | HPQKZNUVDJNXLP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|