C20H24N4O2 — CID 74621923
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-phenylpyrazolidine-4-carboxamide (PubChem CID 74621923) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-phenylpyrazolidine-4-carboxamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-phenylpyrazolidine-4-carboxamide |
|---|---|
| PubChem CID | 74621923 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-phenylpyrazolidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)C1CNNC1c1ccccc1 |
| InChI | InChI=1S/C20H24N4O2/c1-13-7-6-8-14(2)18(13)23-17(25)12-21-20(26)16-11-22-24-19(16)15-9-4-3-5-10-15/h3-10,16,19,22,24H,11-12H2,1-2H3,(H,21,26)(H,23,25) |
| InChIKey | ZYGIDQXWWUKDDK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |