C16H19N5O2 — CID 51107564
(E)-N-[2-oxo-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)amino]ethyl]-3-phenylprop-2-enamide (PubChem CID 51107564) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (E)-N-[2-oxo-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)amino]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-oxo-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)amino]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 51107564 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (E)-N-[2-oxo-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)amino]ethyl]-3-phenylprop-2-enamide |
| SMILES | CC(C)c1nc(NC(=O)CNC(=O)/C=C/c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C16H19N5O2/c1-11(2)15-19-16(21-20-15)18-14(23)10-17-13(22)9-8-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,17,22)(H2,18,19,20,21,23)/b9-8+ |
| InChIKey | BJFJVIAIJBQKKN-CMDGGOBGSA-N |
| XLogP | 1.70 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|