C15H14F3N5O2 — CID 76861191
2-(3-phenylprop-2-enoylamino)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]propanamide (PubChem CID 76861191) has the molecular formula C15H14F3N5O2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 2-(3-phenylprop-2-enoylamino)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 2-(3-phenylprop-2-enoylamino)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 76861191 |
| Molecular Formula | C15H14F3N5O2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-(3-phenylprop-2-enoylamino)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]propanamide |
| SMILES | CC(NC(=O)C=Cc1ccccc1)C(=O)Nc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H14F3N5O2/c1-9(19-11(24)8-7-10-5-3-2-4-6-10)12(25)20-14-21-13(22-23-14)15(16,17)18/h2-9H,1H3,(H,19,24)(H2,20,21,22,23,25) |
| InChIKey | IGYCTSSDHVFUQY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|