C46H28O — CID 177071490
8-(4-benzo[a]anthracen-7-yl-2,3,5,6-tetradeuteriophenyl)-5-phenylnaphtho[1,2-b][1]benzofuran (PubChem CID 177071490) has the molecular formula C46H28O and a molecular weight of 600.75 g/mol. Its IUPAC name is 8-(4-benzo[a]anthracen-7-yl-2,3,5,6-tetradeuteriophenyl)-5-phenylnaphtho[1,2-b][1]benzofuran.
| Compound Name | 8-(4-benzo[a]anthracen-7-yl-2,3,5,6-tetradeuteriophenyl)-5-phenylnaphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 177071490 |
| Molecular Formula | C46H28O |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | 8-(4-benzo[a]anthracen-7-yl-2,3,5,6-tetradeuteriophenyl)-5-phenylnaphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c(-c2c3ccccc3cc3c2ccc2ccccc23)c([2H])c([2H])c1-c1ccc2oc3c4ccccc4c(-c4ccccc4)cc3c2c1 |
| InChI | InChI=1S/C46H28O/c1-2-10-30(11-3-1)40-28-43-42-26-33(23-25-44(42)47-46(43)39-17-9-8-16-37(39)40)29-18-20-32(21-19-29)45-36-15-7-5-13-34(36)27-41-35-14-6-4-12-31(35)22-24-38(41)45/h1-28H/i18D,19D,20D,21D |
| InChIKey | DHTNFBMKQAFLGM-UQKYHCRGSA-N |
| XLogP | 13.20 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|