About CID 177075265
CID 177075265 (PubChem CID 177075265) has the molecular formula C70H65N4OPt-3
and a molecular weight of 1184.46 g/mol.
Molecular Properties
| Compound Name | CID 177075265 |
| PubChem CID | 177075265 |
| Molecular Formula | C70H65N4OPt-3 |
| Molecular Weight | 1184.46 g/mol |
| Exact Mass | 1183.55 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1cccc2c3cccc4c3n(c3c(-c5cc(C(C)(C)C)cc(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c5)cccc3c3ccccc3c12)[CH-]N4c1[c-]c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2cc(C(C)(C)C)ccn2)ccc1)C(C)C.[Pt] |
| InChI | InChI=1S/C70H65N4O.Pt/c1-44(2)36-45-20-16-27-58-60-29-19-31-62-67(60)73(66-53(26-18-28-59(66)54-23-12-13-25-57(54)65(45)58)46-37-48(69(6,7)8)39-49(38-46)70(9,10)11)43-72(62)50-21-17-22-51(41-50)75-52-32-33-56-55-24-14-15-30-61(55)74(63(56)42-52)64-40-47(34-35-71-64)68(3,4)5;/h12-35,37-40,43-44H,36H2,1-11H3;/q-3;/i6D3,7D3,8D3,36D2; |
| InChIKey | SGOITUJYJBSMFQ-NBQIKPHASA-N |
| XLogP | 18.98 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1184.46 |
| LogP ≤ 5 | 18.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 177075265 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177075265?
The IUPAC name of CID 177075265 (CID 177075265) is not available.
What is the SMILES notation for CID 177075265?
The canonical SMILES for CID 177075265 is [2H]C([2H])(c1cccc2c3cccc4c3n(c3c(-c5cc(C(C)(C)C)cc(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c5)cccc3c3ccccc3c12)[CH-]N4c1[c-]c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2cc(C(C)(C)C)ccn2)ccc1)C(C)C.[Pt].
What is the InChIKey of CID 177075265?
The InChIKey is SGOITUJYJBSMFQ-NBQIKPHASA-N. The full InChI is InChI=1S/C70H65N4O.Pt/c1-44(2)36-45-20-16-27-58-60-29-19-31-62-67(60)73(66-53(26-18-28-59(66)54-23-12-13-25-57(54)65(45)58)46-37-48(69(6,7)8)39-49(38-46)70(9,10)11)43-72(62)50-21-17-22-51(41-50)75-52-32-33-56-55-24-14-15-30-61(55)74(63(56)42-52)64-40-47(34-35-71-64)68(3,4)5;/h12-35,37-40,43-44H,36H2,1-11H3;/q-3;/i6D3,7D3,8D3,36D2;.
What are the key properties of CID 177075265?
CID 177075265 has a molecular weight of 1184.46 g/mol, XLogP of 18.98, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177075265 is sourced from PubChem (CID 177075265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).