About CID 177075965
CID 177075965 (PubChem CID 177075965) has the molecular formula C71H67N4OPt-3
and a molecular weight of 1198.49 g/mol.
Molecular Properties
| Compound Name | CID 177075965 |
| PubChem CID | 177075965 |
| Molecular Formula | C71H67N4OPt-3 |
| Molecular Weight | 1198.49 g/mol |
| Exact Mass | 1197.57 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])C(c1cc(-c2cccc3c4cccc(C([2H])([2H])C(C)(C)C)c4c4ccccc4c4cccc5c4n(c23)[CH-]N5c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)ccc2)cc(C(C)(C)C)c1)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Pt] |
| InChI | InChI=1S/C71H67N4O.Pt/c1-68(2,3)43-45-21-17-28-58-60-29-19-27-53(46-37-48(70(7,8)9)39-49(38-46)71(10,11)12)66(60)74-44-73(62-32-20-30-59(67(62)74)54-24-13-14-26-57(54)65(45)58)50-22-18-23-51(41-50)76-52-33-34-56-55-25-15-16-31-61(55)75(63(56)42-52)64-40-47(35-36-72-64)69(4,5)6;/h13-40,44H,43H2,1-12H3;/q-3;/i7D3,8D3,9D3,43D2; |
| InChIKey | YJCGPSXJIXYMIW-OFLZQICCSA-N |
| XLogP | 19.37 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 77 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1198.49 |
| LogP ≤ 5 | 19.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 177075965 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177075965?
The IUPAC name of CID 177075965 (CID 177075965) is not available.
What is the SMILES notation for CID 177075965?
The canonical SMILES for CID 177075965 is [2H]C([2H])([2H])C(c1cc(-c2cccc3c4cccc(C([2H])([2H])C(C)(C)C)c4c4ccccc4c4cccc5c4n(c23)[CH-]N5c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)ccc2)cc(C(C)(C)C)c1)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Pt].
What is the InChIKey of CID 177075965?
The InChIKey is YJCGPSXJIXYMIW-OFLZQICCSA-N. The full InChI is InChI=1S/C71H67N4O.Pt/c1-68(2,3)43-45-21-17-28-58-60-29-19-27-53(46-37-48(70(7,8)9)39-49(38-46)71(10,11)12)66(60)74-44-73(62-32-20-30-59(67(62)74)54-24-13-14-26-57(54)65(45)58)50-22-18-23-51(41-50)76-52-33-34-56-55-25-15-16-31-61(55)75(63(56)42-52)64-40-47(35-36-72-64)69(4,5)6;/h13-40,44H,43H2,1-12H3;/q-3;/i7D3,8D3,9D3,43D2;.
What are the key properties of CID 177075965?
CID 177075965 has a molecular weight of 1198.49 g/mol, XLogP of 19.37, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177075965 is sourced from PubChem (CID 177075965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).