C24H31F3N7O7P — CID 177077018
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2,4-difluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 177077018) has the molecular formula C24H31F3N7O7P and a molecular weight of 617.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2,4-difluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2,4-difluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 177077018 |
| Molecular Formula | C24H31F3N7O7P |
| Molecular Weight | 617.52 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2,4-difluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccc(F)cc2F)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C24H31F3N7O7P/c1-11(2)39-21(36)12(3)33-42(37,41-15-7-6-13(25)8-14(15)26)38-9-16-18(35)24(4,27)22(40-16)34-10-30-17-19(29-5)31-23(28)32-20(17)34/h6-8,10-12,16,18,22,35H,9H2,1-5H3,(H,33,37)(H3,28,29,31,32)/t12-,16+,18+,22+,24+,42?/m0/s1 |
| InChIKey | CHJBFVYQRXMZAE-QDIFBXEYSA-N |
| XLogP | 2.85 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|