C20H32O3 — CID 177078249
(3R,5S,8S,9S,10S,12R,14S)-3-hydroxy-12-methoxy-3,10-dimethyl-1,2,4,5,6,7,8,9,11,12,13,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 177078249) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (3R,5S,8S,9S,10S,12R,14S)-3-hydroxy-12-methoxy-3,10-dimethyl-1,2,4,5,6,7,8,9,11,12,13,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5S,8S,9S,10S,12R,14S)-3-hydroxy-12-methoxy-3,10-dimethyl-1,2,4,5,6,7,8,9,11,12,13,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 177078249 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (3R,5S,8S,9S,10S,12R,14S)-3-hydroxy-12-methoxy-3,10-dimethyl-1,2,4,5,6,7,8,9,11,12,13,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CO[C@@H]1C[C@H]2[C@@H](CC[C@H]3C[C@](C)(O)CC[C@@]32C)[C@@H]2CCC(=O)C21 |
| InChI | InChI=1S/C20H32O3/c1-19(22)8-9-20(2)12(11-19)4-5-13-14-6-7-16(21)18(14)17(23-3)10-15(13)20/h12-15,17-18,22H,4-11H2,1-3H3/t12-,13-,14-,15-,17+,18?,19+,20-/m0/s1 |
| InChIKey | TWJHZGGAKCXRMR-OVGBATNHSA-N |
| XLogP | 3.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |