C23H38O2 — CID 145443154
(3R,5S,9S,10S,13S,14S,16R,17E)-17-ethylidene-16-methoxy-3,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 145443154) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is (3R,5S,9S,10S,13S,14S,16R,17E)-17-ethylidene-16-methoxy-3,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,9S,10S,13S,14S,16R,17E)-17-ethylidene-16-methoxy-3,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145443154 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | (3R,5S,9S,10S,13S,14S,16R,17E)-17-ethylidene-16-methoxy-3,10,13-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C/C=C1/[C@H](OC)C[C@H]2C3CC[C@H]4C[C@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H38O2/c1-6-17-20(25-5)13-19-16-8-7-15-14-21(2,24)11-12-22(15,3)18(16)9-10-23(17,19)4/h6,15-16,18-20,24H,7-14H2,1-5H3/b17-6-/t15-,16?,18-,19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | DPKYBRHXDOUTQB-BZDBMEJESA-N |
| XLogP | 5.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|