C55H105FN2O5 — CID 177078521
1-O-(2-butylheptyl) 19-O-(2-propylhexyl) 10-[2-fluorononanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate (PubChem CID 177078521) has the molecular formula C55H105FN2O5 and a molecular weight of 893.45 g/mol. Its IUPAC name is 1-O-(2-butylheptyl) 19-O-(2-propylhexyl) 10-[2-fluorononanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate.
| Compound Name | 1-O-(2-butylheptyl) 19-O-(2-propylhexyl) 10-[2-fluorononanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate |
|---|---|
| PubChem CID | 177078521 |
| Molecular Formula | C55H105FN2O5 |
| Molecular Weight | 893.45 g/mol |
| Exact Mass | 892.80 |
| IUPAC Name | 1-O-(2-butylheptyl) 19-O-(2-propylhexyl) 10-[2-fluorononanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate |
| SMILES | CCCCCCCC(F)C(=O)N(CCCN1CCCC1)C(CCCCCCCCC(=O)OCC(CCC)CCCC)CCCCCCCCC(=O)OCC(CCCC)CCCCC |
| InChI | InChI=1S/C55H105FN2O5/c1-6-11-15-20-28-40-52(56)55(61)58(46-33-45-57-43-31-32-44-57)51(38-26-21-16-18-23-29-41-53(59)62-47-49(34-10-5)35-13-8-3)39-27-22-17-19-24-30-42-54(60)63-48-50(36-14-9-4)37-25-12-7-2/h49-52H,6-48H2,1-5H3 |
| InChIKey | VVWZKNUOWALRFR-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.45 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|