C66H119NO4Si2 — CID 177079509
methyl (2S)-2-[[3,5-bis(trioctylsilyl)phenyl]methoxycarbonylamino]-3-phenylpropanoate (PubChem CID 177079509) has the molecular formula C66H119NO4Si2 and a molecular weight of 1046.85 g/mol. Its IUPAC name is methyl (2S)-2-[[3,5-bis(trioctylsilyl)phenyl]methoxycarbonylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3,5-bis(trioctylsilyl)phenyl]methoxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 177079509 |
| Molecular Formula | C66H119NO4Si2 |
| Molecular Weight | 1046.85 g/mol |
| Exact Mass | 1045.87 |
| IUPAC Name | methyl (2S)-2-[[3,5-bis(trioctylsilyl)phenyl]methoxycarbonylamino]-3-phenylpropanoate |
| SMILES | CCCCCCCC[Si](CCCCCCCC)(CCCCCCCC)c1cc(COC(=O)N[C@@H](Cc2ccccc2)C(=O)OC)cc([Si](CCCCCCCC)(CCCCCCCC)CCCCCCCC)c1 |
| InChI | InChI=1S/C66H119NO4Si2/c1-8-14-20-26-32-41-49-72(50-42-33-27-21-15-9-2,51-43-34-28-22-16-10-3)62-55-61(59-71-66(69)67-64(65(68)70-7)57-60-47-39-38-40-48-60)56-63(58-62)73(52-44-35-29-23-17-11-4,53-45-36-30-24-18-12-5)54-46-37-31-25-19-13-6/h38-40,47-48,55-56,58,64H,8-37,41-46,49-54,57,59H2,1-7H3,(H,67,69)/t64-/m0/s1 |
| InChIKey | WCTHKGXVIZQBMR-JVUALNACSA-N |
| XLogP | 20.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1046.85 |
| LogP ≤ 5 | 20.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|