C29H24BNO4 — CID 177086249
5-phenyl-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,11-dioxa-4-azapentacyclo[10.8.0.02,10.03,7.015,20]icosa-1(12),2(10),3(7),4,8,13,15(20),16,18-nonaene (PubChem CID 177086249) has the molecular formula C29H24BNO4 and a molecular weight of 461.33 g/mol. Its IUPAC name is 5-phenyl-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,11-dioxa-4-azapentacyclo[10.8.0.02,10.03,7.015,20]icosa-1(12),2(10),3(7),4,8,13,15(20),16,18-nonaene.
| Compound Name | 5-phenyl-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,11-dioxa-4-azapentacyclo[10.8.0.02,10.03,7.015,20]icosa-1(12),2(10),3(7),4,8,13,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 177086249 |
| Molecular Formula | C29H24BNO4 |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 5-phenyl-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,11-dioxa-4-azapentacyclo[10.8.0.02,10.03,7.015,20]icosa-1(12),2(10),3(7),4,8,13,15(20),16,18-nonaene |
| SMILES | CC1(C)OB(c2ccc3c(ccc4oc5ccc6oc(-c7ccccc7)nc6c5c43)c2)OC1(C)C |
| InChI | InChI=1S/C29H24BNO4/c1-28(2)29(3,4)35-30(34-28)19-11-12-20-18(16-19)10-13-21-24(20)25-22(32-21)14-15-23-26(25)31-27(33-23)17-8-6-5-7-9-17/h5-16H,1-4H3 |
| InChIKey | TUEYOYAEDYBPGP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 57.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|