C21H18N4O2 — CID 177088600
3-(4-isocyanophenyl)-7-[(4-methoxyphenyl)methyl]-5,8-dihydroimidazo[1,2-a]pyrazin-6-one (PubChem CID 177088600) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-(4-isocyanophenyl)-7-[(4-methoxyphenyl)methyl]-5,8-dihydroimidazo[1,2-a]pyrazin-6-one.
| Compound Name | 3-(4-isocyanophenyl)-7-[(4-methoxyphenyl)methyl]-5,8-dihydroimidazo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 177088600 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-(4-isocyanophenyl)-7-[(4-methoxyphenyl)methyl]-5,8-dihydroimidazo[1,2-a]pyrazin-6-one |
| SMILES | [C-]#[N+]c1ccc(-c2cnc3n2CC(=O)N(Cc2ccc(OC)cc2)C3)cc1 |
| InChI | InChI=1S/C21H18N4O2/c1-22-17-7-5-16(6-8-17)19-11-23-20-13-24(21(26)14-25(19)20)12-15-3-9-18(27-2)10-4-15/h3-11H,12-14H2,2H3 |
| InChIKey | KZCMQTCABAUKJH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|