3,5-bis(2-methoxyethoxy)hexanoyl azide

C12H23N3O5 — CID 177091074

IUPAC3,5-bis(2-methoxyethoxy)hexanoyl azide
SMILESCOCCOC(C)CC(CC(=O)N=[N+]=[N-])OCCOC
InChIInChI=1S/C12H23N3O5/c1-10(19-6-4-17-2)8-11(20-7-5-18-3)9-12(16)14-15-13/h10-11H,4-9H2,1-3H3
InChIKeyGIWCGJPPPNKPCD-UHFFFAOYSA-N
MW289.33 g/mol
LogP1.69
Rot. Bonds12

About 3,5-bis(2-methoxyethoxy)hexanoyl azide

3,5-bis(2-methoxyethoxy)hexanoyl azide (PubChem CID 177091074) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3,5-bis(2-methoxyethoxy)hexanoyl azide.

Molecular Properties

Compound Name3,5-bis(2-methoxyethoxy)hexanoyl azide
PubChem CID177091074
Molecular FormulaC12H23N3O5
Molecular Weight289.33 g/mol
Exact Mass289.16
IUPAC Name3,5-bis(2-methoxyethoxy)hexanoyl azide
SMILESCOCCOC(C)CC(CC(=O)N=[N+]=[N-])OCCOC
InChIInChI=1S/C12H23N3O5/c1-10(19-6-4-17-2)8-11(20-7-5-18-3)9-12(16)14-15-13/h10-11H,4-9H2,1-3H3
InChIKeyGIWCGJPPPNKPCD-UHFFFAOYSA-N
XLogP1.69
TPSA102.75 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds12
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.33
LogP ≤ 51.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 3,5-bis(2-methoxyethoxy)hexanoyl azide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis(2-methoxyethoxy)hexanoyl azide?
The IUPAC name of 3,5-bis(2-methoxyethoxy)hexanoyl azide (CID 177091074) is 3,5-bis(2-methoxyethoxy)hexanoyl azide.
What is the SMILES notation for 3,5-bis(2-methoxyethoxy)hexanoyl azide?
The canonical SMILES for 3,5-bis(2-methoxyethoxy)hexanoyl azide is COCCOC(C)CC(CC(=O)N=[N+]=[N-])OCCOC.
What is the InChIKey of 3,5-bis(2-methoxyethoxy)hexanoyl azide?
The InChIKey is GIWCGJPPPNKPCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O5/c1-10(19-6-4-17-2)8-11(20-7-5-18-3)9-12(16)14-15-13/h10-11H,4-9H2,1-3H3.
What are the key properties of 3,5-bis(2-methoxyethoxy)hexanoyl azide?
3,5-bis(2-methoxyethoxy)hexanoyl azide has a molecular weight of 289.33 g/mol, XLogP of 1.69, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(2-methoxyethoxy)hexanoyl azide is sourced from PubChem (CID 177091074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).