C12H23N3O5 — CID 177091074
3,5-bis(2-methoxyethoxy)hexanoyl azide (PubChem CID 177091074) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3,5-bis(2-methoxyethoxy)hexanoyl azide.
| Compound Name | 3,5-bis(2-methoxyethoxy)hexanoyl azide |
|---|---|
| PubChem CID | 177091074 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3,5-bis(2-methoxyethoxy)hexanoyl azide |
| SMILES | COCCOC(C)CC(CC(=O)N=[N+]=[N-])OCCOC |
| InChI | InChI=1S/C12H23N3O5/c1-10(19-6-4-17-2)8-11(20-7-5-18-3)9-12(16)14-15-13/h10-11H,4-9H2,1-3H3 |
| InChIKey | GIWCGJPPPNKPCD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|