C12H25NO5 — CID 177091075
3,5-bis(2-methoxyethoxy)hexanamide (PubChem CID 177091075) has the molecular formula C12H25NO5 and a molecular weight of 263.33 g/mol. Its IUPAC name is 3,5-bis(2-methoxyethoxy)hexanamide.
| Compound Name | 3,5-bis(2-methoxyethoxy)hexanamide |
|---|---|
| PubChem CID | 177091075 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3,5-bis(2-methoxyethoxy)hexanamide |
| SMILES | COCCOC(C)CC(CC(N)=O)OCCOC |
| InChI | InChI=1S/C12H25NO5/c1-10(17-6-4-15-2)8-11(9-12(13)14)18-7-5-16-3/h10-11H,4-9H2,1-3H3,(H2,13,14) |
| InChIKey | KJUBXKFUESNWCS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|