C25H56N2O8SSi — CID 177092003
3-[[1-[3-[diheptyl(methyl)azaniumyl]propyl-dihydroxysilyl]oxy-3-hydroxy-2-(hydroxymethyl)propan-2-yl]amino]propane-1-sulfonate (PubChem CID 177092003) has the molecular formula C25H56N2O8SSi and a molecular weight of 572.88 g/mol. Its IUPAC name is 3-[[1-[3-[diheptyl(methyl)azaniumyl]propyl-dihydroxysilyl]oxy-3-hydroxy-2-(hydroxymethyl)propan-2-yl]amino]propane-1-sulfonate.
| Compound Name | 3-[[1-[3-[diheptyl(methyl)azaniumyl]propyl-dihydroxysilyl]oxy-3-hydroxy-2-(hydroxymethyl)propan-2-yl]amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 177092003 |
| Molecular Formula | C25H56N2O8SSi |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | 3-[[1-[3-[diheptyl(methyl)azaniumyl]propyl-dihydroxysilyl]oxy-3-hydroxy-2-(hydroxymethyl)propan-2-yl]amino]propane-1-sulfonate |
| SMILES | CCCCCCC[N+](C)(CCCCCCC)CCC[Si](O)(O)OCC(CO)(CO)NCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C25H56N2O8SSi/c1-4-6-8-10-12-17-27(3,18-13-11-9-7-5-2)19-15-21-37(33,34)35-24-25(22-28,23-29)26-16-14-20-36(30,31)32/h26,28-29,33-34H,4-24H2,1-3H3 |
| InChIKey | NTKAFMGOIXKJFE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|