C17H32 — CID 177092419
1,5-di(propan-2-yl)bicyclo[3.3.3]undecane (PubChem CID 177092419) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 1,5-di(propan-2-yl)bicyclo[3.3.3]undecane.
| Compound Name | 1,5-di(propan-2-yl)bicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 177092419 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 1,5-di(propan-2-yl)bicyclo[3.3.3]undecane |
| SMILES | CC(C)C12CCCC(C(C)C)(CCC1)CCC2 |
| InChI | InChI=1S/C17H32/c1-14(2)16-8-5-11-17(15(3)4,12-6-9-16)13-7-10-16/h14-15H,5-13H2,1-4H3 |
| InChIKey | SWEHUEVVQGDOAS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |