C22H40 — CID 11381171
1,3,5,7-tetra(propan-2-yl)adamantane (PubChem CID 11381171) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 1,3,5,7-tetra(propan-2-yl)adamantane.
| Compound Name | 1,3,5,7-tetra(propan-2-yl)adamantane |
|---|---|
| PubChem CID | 11381171 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 1,3,5,7-tetra(propan-2-yl)adamantane |
| SMILES | CC(C)C12CC3(C(C)C)CC(C(C)C)(C1)CC(C(C)C)(C2)C3 |
| InChI | InChI=1S/C22H40/c1-15(2)19-9-20(16(3)4)12-21(10-19,17(5)6)14-22(11-19,13-20)18(7)8/h15-18H,9-14H2,1-8H3 |
| InChIKey | PYSKLPWSFWJSDJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |