C12H23O7P — CID 177092599
2-(2-methoxyethoxy)ethyl [1-(2-methylpropanoyl)cyclopropyl] hydrogen phosphate (PubChem CID 177092599) has the molecular formula C12H23O7P and a molecular weight of 310.28 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl [1-(2-methylpropanoyl)cyclopropyl] hydrogen phosphate.
| Compound Name | 2-(2-methoxyethoxy)ethyl [1-(2-methylpropanoyl)cyclopropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 177092599 |
| Molecular Formula | C12H23O7P |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl [1-(2-methylpropanoyl)cyclopropyl] hydrogen phosphate |
| SMILES | COCCOCCOP(=O)(O)OC1(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C12H23O7P/c1-10(2)11(13)12(4-5-12)19-20(14,15)18-9-8-17-7-6-16-3/h10H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | GIVPWFDVBDQLHY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|