C11H24NO6P — CID 176600894
2-[2-(2-methylpropanoylamino)ethoxy]ethyl propan-2-yl hydrogen phosphate (PubChem CID 176600894) has the molecular formula C11H24NO6P and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-[2-(2-methylpropanoylamino)ethoxy]ethyl propan-2-yl hydrogen phosphate.
| Compound Name | 2-[2-(2-methylpropanoylamino)ethoxy]ethyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 176600894 |
| Molecular Formula | C11H24NO6P |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[2-(2-methylpropanoylamino)ethoxy]ethyl propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OCCOCCNC(=O)C(C)C |
| InChI | InChI=1S/C11H24NO6P/c1-9(2)11(13)12-5-6-16-7-8-17-19(14,15)18-10(3)4/h9-10H,5-8H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | LAYQNUYSBKLJCB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|