C44H33N3O — CID 177095634
10-[6-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)phenyl]-2-pyridinyl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaen-9-ol (PubChem CID 177095634) has the molecular formula C44H33N3O and a molecular weight of 619.77 g/mol. Its IUPAC name is 10-[6-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)phenyl]-2-pyridinyl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaen-9-ol.
| Compound Name | 10-[6-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)phenyl]-2-pyridinyl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaen-9-ol |
|---|---|
| PubChem CID | 177095634 |
| Molecular Formula | C44H33N3O |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 10-[6-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)phenyl]-2-pyridinyl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaen-9-ol |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccc3)ccn2)cc(-c2cccc(-c3cc4c5ccccc5n5c6ccccc6c(c3O)c45)n2)c1 |
| InChI | InChI=1S/C44H33N3O/c1-44(2,3)31-23-29(22-30(24-31)38-25-28(20-21-45-38)27-12-5-4-6-13-27)36-16-11-17-37(46-36)35-26-34-32-14-7-9-18-39(32)47-40-19-10-8-15-33(40)41(42(34)47)43(35)48/h4-26,48H,1-3H3 |
| InChIKey | NVLRBORZLZVEIC-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |