C42H31N3O2 — CID 177294253
4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)phenyl]-16-oxa-3,6-diazahexacyclo[11.11.0.02,6.07,12.015,23.017,22]tetracosa-1(24),2,4,7,9,11,13,15(23),17,19,21-undecaen-24-ol (PubChem CID 177294253) has the molecular formula C42H31N3O2 and a molecular weight of 609.73 g/mol. Its IUPAC name is 4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)phenyl]-16-oxa-3,6-diazahexacyclo[11.11.0.02,6.07,12.015,23.017,22]tetracosa-1(24),2,4,7,9,11,13,15(23),17,19,21-undecaen-24-ol.
| Compound Name | 4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)phenyl]-16-oxa-3,6-diazahexacyclo[11.11.0.02,6.07,12.015,23.017,22]tetracosa-1(24),2,4,7,9,11,13,15(23),17,19,21-undecaen-24-ol |
|---|---|
| PubChem CID | 177294253 |
| Molecular Formula | C42H31N3O2 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)phenyl]-16-oxa-3,6-diazahexacyclo[11.11.0.02,6.07,12.015,23.017,22]tetracosa-1(24),2,4,7,9,11,13,15(23),17,19,21-undecaen-24-ol |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccc3)ccn2)cc(-c2cn3c4ccccc4c4cc5oc6ccccc6c5c(O)c4c3n2)c1 |
| InChI | InChI=1S/C42H31N3O2/c1-42(2,3)29-20-27(33-22-26(17-18-43-33)25-11-5-4-6-12-25)19-28(21-29)34-24-45-35-15-9-7-13-30(35)32-23-37-38(40(46)39(32)41(45)44-34)31-14-8-10-16-36(31)47-37/h4-24,46H,1-3H3 |
| InChIKey | WHNZQIPUBWIGPU-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 63.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|