C15H12F4N2O2S2 — CID 177099805
N-ethyl-5-isocyano-N-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]thiophene-3-sulfonamide (PubChem CID 177099805) has the molecular formula C15H12F4N2O2S2 and a molecular weight of 392.40 g/mol. Its IUPAC name is N-ethyl-5-isocyano-N-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]thiophene-3-sulfonamide.
| Compound Name | N-ethyl-5-isocyano-N-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 177099805 |
| Molecular Formula | C15H12F4N2O2S2 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-ethyl-5-isocyano-N-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]thiophene-3-sulfonamide |
| SMILES | [C-]#[N+]c1cc(S(=O)(=O)N(CC)[C@H](c2ccc(F)cc2)C(F)(F)F)cs1 |
| InChI | InChI=1S/C15H12F4N2O2S2/c1-3-21(25(22,23)12-8-13(20-2)24-9-12)14(15(17,18)19)10-4-6-11(16)7-5-10/h4-9,14H,3H2,1H3/t14-/m1/s1 |
| InChIKey | PQILSSWOFNWNIH-CQSZACIVSA-N |
| XLogP | 4.75 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|