About quinoxalin-2-yl quinoxaline-2-carboxylate
quinoxalin-2-yl quinoxaline-2-carboxylate (PubChem CID 177101519) has the molecular formula C17H10N4O2
and a molecular weight of 302.29 g/mol. Its IUPAC name is quinoxalin-2-yl quinoxaline-2-carboxylate.
Molecular Properties
| Compound Name | quinoxalin-2-yl quinoxaline-2-carboxylate |
| PubChem CID | 177101519 |
| Molecular Formula | C17H10N4O2 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | quinoxalin-2-yl quinoxaline-2-carboxylate |
| SMILES | O=C(Oc1cnc2ccccc2n1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C17H10N4O2/c22-17(15-9-18-11-5-1-3-7-13(11)20-15)23-16-10-19-12-6-2-4-8-14(12)21-16/h1-10H |
| InChIKey | BONXEKAZTGKCPO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze quinoxalin-2-yl quinoxaline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxalin-2-yl quinoxaline-2-carboxylate?
The IUPAC name of quinoxalin-2-yl quinoxaline-2-carboxylate (CID 177101519) is quinoxalin-2-yl quinoxaline-2-carboxylate.
What is the SMILES notation for quinoxalin-2-yl quinoxaline-2-carboxylate?
The canonical SMILES for quinoxalin-2-yl quinoxaline-2-carboxylate is O=C(Oc1cnc2ccccc2n1)c1cnc2ccccc2n1.
What is the InChIKey of quinoxalin-2-yl quinoxaline-2-carboxylate?
The InChIKey is BONXEKAZTGKCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N4O2/c22-17(15-9-18-11-5-1-3-7-13(11)20-15)23-16-10-19-12-6-2-4-8-14(12)21-16/h1-10H.
What are the key properties of quinoxalin-2-yl quinoxaline-2-carboxylate?
quinoxalin-2-yl quinoxaline-2-carboxylate has a molecular weight of 302.29 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxalin-2-yl quinoxaline-2-carboxylate is sourced from PubChem (CID 177101519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).