C16H17F2N3O — CID 177101521
4-(4,4-difluoroazepan-1-yl)quinoline-6-carboxamide (PubChem CID 177101521) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-(4,4-difluoroazepan-1-yl)quinoline-6-carboxamide.
| Compound Name | 4-(4,4-difluoroazepan-1-yl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 177101521 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-(4,4-difluoroazepan-1-yl)quinoline-6-carboxamide |
| SMILES | NC(=O)c1ccc2nccc(N3CCCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C16H17F2N3O/c17-16(18)5-1-8-21(9-6-16)14-4-7-20-13-3-2-11(15(19)22)10-12(13)14/h2-4,7,10H,1,5-6,8-9H2,(H2,19,22) |
| InChIKey | ZIUDYRDLALSYQT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |