C24H32FN3O — CID 121318090
2-[1-(6-fluoroquinolin-4-yl)-4-methylpiperidin-4-yl]-N-(1-methylcyclohexyl)acetamide (PubChem CID 121318090) has the molecular formula C24H32FN3O and a molecular weight of 397.54 g/mol. Its IUPAC name is 2-[1-(6-fluoroquinolin-4-yl)-4-methylpiperidin-4-yl]-N-(1-methylcyclohexyl)acetamide.
| Compound Name | 2-[1-(6-fluoroquinolin-4-yl)-4-methylpiperidin-4-yl]-N-(1-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 121318090 |
| Molecular Formula | C24H32FN3O |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 2-[1-(6-fluoroquinolin-4-yl)-4-methylpiperidin-4-yl]-N-(1-methylcyclohexyl)acetamide |
| SMILES | CC1(CC(=O)NC2(C)CCCCC2)CCN(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H32FN3O/c1-23(17-22(29)27-24(2)9-4-3-5-10-24)11-14-28(15-12-23)21-8-13-26-20-7-6-18(25)16-19(20)21/h6-8,13,16H,3-5,9-12,14-15,17H2,1-2H3,(H,27,29) |
| InChIKey | KELVXCWWJRQKIT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |