C28H33N5O — CID 177106029
(5S)-5-butyl-1-(2,3-dimethylphenyl)-4-[[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methyl]piperazin-2-one (PubChem CID 177106029) has the molecular formula C28H33N5O and a molecular weight of 455.61 g/mol. Its IUPAC name is (5S)-5-butyl-1-(2,3-dimethylphenyl)-4-[[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methyl]piperazin-2-one.
| Compound Name | (5S)-5-butyl-1-(2,3-dimethylphenyl)-4-[[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 177106029 |
| Molecular Formula | C28H33N5O |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (5S)-5-butyl-1-(2,3-dimethylphenyl)-4-[[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methyl]piperazin-2-one |
| SMILES | [C-]#[N+]c1ccc(Cn2cncc2CN2CC(=O)N(c3cccc(C)c3C)C[C@@H]2CCCC)cc1 |
| InChI | InChI=1S/C28H33N5O/c1-5-6-9-25-18-33(27-10-7-8-21(2)22(27)3)28(34)19-31(25)17-26-15-30-20-32(26)16-23-11-13-24(29-4)14-12-23/h7-8,10-15,20,25H,5-6,9,16-19H2,1-3H3/t25-/m0/s1 |
| InChIKey | PNFKECNFUFYZSO-VWLOTQADSA-N |
| XLogP | 5.51 |
| TPSA | 45.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|