C27H30BrF3N4O2 — CID 167312183
(5S)-4-[[3-[(4-bromophenyl)methyl]imidazol-4-yl]methyl]-5-pentyl-1-[3-(trifluoromethoxy)phenyl]piperazin-2-one (PubChem CID 167312183) has the molecular formula C27H30BrF3N4O2 and a molecular weight of 579.46 g/mol. Its IUPAC name is (5S)-4-[[3-[(4-bromophenyl)methyl]imidazol-4-yl]methyl]-5-pentyl-1-[3-(trifluoromethoxy)phenyl]piperazin-2-one.
| Compound Name | (5S)-4-[[3-[(4-bromophenyl)methyl]imidazol-4-yl]methyl]-5-pentyl-1-[3-(trifluoromethoxy)phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 167312183 |
| Molecular Formula | C27H30BrF3N4O2 |
| Molecular Weight | 579.46 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | (5S)-4-[[3-[(4-bromophenyl)methyl]imidazol-4-yl]methyl]-5-pentyl-1-[3-(trifluoromethoxy)phenyl]piperazin-2-one |
| SMILES | CCCCC[C@H]1CN(c2cccc(OC(F)(F)F)c2)C(=O)CN1Cc1cncn1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C27H30BrF3N4O2/c1-2-3-4-6-23-17-35(22-7-5-8-25(13-22)37-27(29,30)31)26(36)18-33(23)16-24-14-32-19-34(24)15-20-9-11-21(28)12-10-20/h5,7-14,19,23H,2-4,6,15-18H2,1H3/t23-/m0/s1 |
| InChIKey | QAGCNFGATJLWMQ-QHCPKHFHSA-N |
| XLogP | 6.39 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|