C29H24F3N5O3 — CID 177106023
4-[[3-[(4-isocyano-3-phenoxyphenyl)methyl]imidazol-4-yl]methyl]-1-[3-(trifluoromethoxy)phenyl]piperazin-2-one (PubChem CID 177106023) has the molecular formula C29H24F3N5O3 and a molecular weight of 547.54 g/mol. Its IUPAC name is 4-[[3-[(4-isocyano-3-phenoxyphenyl)methyl]imidazol-4-yl]methyl]-1-[3-(trifluoromethoxy)phenyl]piperazin-2-one.
| Compound Name | 4-[[3-[(4-isocyano-3-phenoxyphenyl)methyl]imidazol-4-yl]methyl]-1-[3-(trifluoromethoxy)phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 177106023 |
| Molecular Formula | C29H24F3N5O3 |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 4-[[3-[(4-isocyano-3-phenoxyphenyl)methyl]imidazol-4-yl]methyl]-1-[3-(trifluoromethoxy)phenyl]piperazin-2-one |
| SMILES | [C-]#[N+]c1ccc(Cn2cncc2CN2CCN(c3cccc(OC(F)(F)F)c3)C(=O)C2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C29H24F3N5O3/c1-33-26-11-10-21(14-27(26)39-24-7-3-2-4-8-24)17-36-20-34-16-23(36)18-35-12-13-37(28(38)19-35)22-6-5-9-25(15-22)40-29(30,31)32/h2-11,14-16,20H,12-13,17-19H2 |
| InChIKey | GEHIJKZPFRECME-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 64.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|