C28H26F3N5O3 — CID 59929897
8-[[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decane-1,3-dione (PubChem CID 59929897) has the molecular formula C28H26F3N5O3 and a molecular weight of 537.54 g/mol. Its IUPAC name is 8-[[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decane-1,3-dione.
| Compound Name | 8-[[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 59929897 |
| Molecular Formula | C28H26F3N5O3 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 8-[[3-[(4-isocyanophenyl)methyl]imidazol-4-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decane-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(Cn2cncc2CN2CCC3(CC2)CC(=O)N(Cc2cccc(OC(F)(F)F)c2)C3=O)cc1 |
| InChI | InChI=1S/C28H26F3N5O3/c1-32-22-7-5-20(6-8-22)16-35-19-33-15-23(35)18-34-11-9-27(10-12-34)14-25(37)36(26(27)38)17-21-3-2-4-24(13-21)39-28(29,30)31/h2-8,13,15,19H,9-12,14,16-18H2 |
| InChIKey | GTRWYPMPBOCJTD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|