C18H25F3N2O — CID 145394661
ethane;2-[4-methyl-1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]acetonitrile (PubChem CID 145394661) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is ethane;2-[4-methyl-1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]acetonitrile.
| Compound Name | ethane;2-[4-methyl-1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 145394661 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethane;2-[4-methyl-1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]acetonitrile |
| SMILES | CC.CC1(CC#N)CCN(Cc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H19F3N2O.C2H6/c1-15(5-8-20)6-9-21(10-7-15)12-13-3-2-4-14(11-13)22-16(17,18)19;1-2/h2-4,11H,5-7,9-10,12H2,1H3;1-2H3 |
| InChIKey | UJXGLJNTXULWQB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |