C24H32N2 — CID 145395051
ethane;2-[4-methyl-1-[(3-methyl-4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile (PubChem CID 145395051) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is ethane;2-[4-methyl-1-[(3-methyl-4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile.
| Compound Name | ethane;2-[4-methyl-1-[(3-methyl-4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 145395051 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | ethane;2-[4-methyl-1-[(3-methyl-4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile |
| SMILES | CC.Cc1cc(CN2CCC(C)(CC#N)CC2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C22H26N2.C2H6/c1-18-16-19(8-9-21(18)20-6-4-3-5-7-20)17-24-14-11-22(2,10-13-23)12-15-24;1-2/h3-9,16H,10-12,14-15,17H2,1-2H3;1-2H3 |
| InChIKey | RRRZQEWVBLYZCX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |