C19H28ClN3O — CID 145394795
N-[2-chloro-5-[[4-(cyanomethyl)-4-methylpiperidin-1-yl]methyl]phenyl]acetamide;ethane (PubChem CID 145394795) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is N-[2-chloro-5-[[4-(cyanomethyl)-4-methylpiperidin-1-yl]methyl]phenyl]acetamide;ethane.
| Compound Name | N-[2-chloro-5-[[4-(cyanomethyl)-4-methylpiperidin-1-yl]methyl]phenyl]acetamide;ethane |
|---|---|
| PubChem CID | 145394795 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[2-chloro-5-[[4-(cyanomethyl)-4-methylpiperidin-1-yl]methyl]phenyl]acetamide;ethane |
| SMILES | CC.CC(=O)Nc1cc(CN2CCC(C)(CC#N)CC2)ccc1Cl |
| InChI | InChI=1S/C17H22ClN3O.C2H6/c1-13(22)20-16-11-14(3-4-15(16)18)12-21-9-6-17(2,5-8-19)7-10-21;1-2/h3-4,11H,5-7,9-10,12H2,1-2H3,(H,20,22);1-2H3 |
| InChIKey | AQNFYDLNAVLCHZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |