C17H25N3O2S — CID 147386176
N-[3-[[4-(cyanomethyl)-4-methylpiperidin-1-yl]methyl]phenyl]ethanesulfonamide (PubChem CID 147386176) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[3-[[4-(cyanomethyl)-4-methylpiperidin-1-yl]methyl]phenyl]ethanesulfonamide.
| Compound Name | N-[3-[[4-(cyanomethyl)-4-methylpiperidin-1-yl]methyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 147386176 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[3-[[4-(cyanomethyl)-4-methylpiperidin-1-yl]methyl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cccc(CN2CCC(C)(CC#N)CC2)c1 |
| InChI | InChI=1S/C17H25N3O2S/c1-3-23(21,22)19-16-6-4-5-15(13-16)14-20-11-8-17(2,7-10-18)9-12-20/h4-6,13,19H,3,7-9,11-12,14H2,1-2H3 |
| InChIKey | DLYHRWTZCXEKLQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |