C25H36N4O3 — CID 177106568
1-[5-isocyano-2-[3-[(2-methylpropan-2-yl)oxy]prop-1-ynyl]-4-pyridinyl]-4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxypiperazine (PubChem CID 177106568) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 1-[5-isocyano-2-[3-[(2-methylpropan-2-yl)oxy]prop-1-ynyl]-4-pyridinyl]-4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxypiperazine.
| Compound Name | 1-[5-isocyano-2-[3-[(2-methylpropan-2-yl)oxy]prop-1-ynyl]-4-pyridinyl]-4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxypiperazine |
|---|---|
| PubChem CID | 177106568 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 1-[5-isocyano-2-[3-[(2-methylpropan-2-yl)oxy]prop-1-ynyl]-4-pyridinyl]-4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxypiperazine |
| SMILES | [C-]#[N+]c1cnc(C#CCOC(C)(C)C)cc1N1CCN(OC2CC(OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C25H36N4O3/c1-24(2,3)30-14-8-9-19-15-23(22(26-7)18-27-19)28-10-12-29(13-11-28)32-21-16-20(17-21)31-25(4,5)6/h15,18,20-21H,10-14,16-17H2,1-6H3 |
| InChIKey | OYLKPFRWNLLALG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|