C41H38GeIrN2SSi-2 — CID 177109769
CID 177109769 (PubChem CID 177109769) has the molecular formula C41H38GeIrN2SSi-2 and a molecular weight of 889.79 g/mol.
| Compound Name | CID 177109769 |
|---|---|
| PubChem CID | 177109769 |
| Molecular Formula | C41H38GeIrN2SSi-2 |
| Molecular Weight | 889.79 g/mol |
| Exact Mass | 891.18 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2sc2cc4c(cc23)[Ge](C)(C)c2ccccc2-4)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C27H22GeNS.C14H16NSi.Ir/c1-16-12-25(29-15-17(16)2)20-10-7-9-19-22-13-24-21(14-26(22)30-27(19)20)18-8-5-6-11-23(18)28(24,3)4;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h5-9,11-15H,1-4H3;4-7,9-11H,1-3H3;/q2*-1;/i1D3,2D3;; |
| InChIKey | UKXYXDIFWNLAHN-ADBWCSELSA-N |
| XLogP | 9.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.79 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|