C33H24F3N2O2Pt- — CID 177110173
2-[4-[3-(6-tert-butylquinolin-8-yl)-5-(trifluoromethyl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum (PubChem CID 177110173) has the molecular formula C33H24F3N2O2Pt- and a molecular weight of 732.64 g/mol. Its IUPAC name is 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-(trifluoromethyl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-(trifluoromethyl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110173 |
| Molecular Formula | C33H24F3N2O2Pt- |
| Molecular Weight | 732.64 g/mol |
| Exact Mass | 732.14 |
| IUPAC Name | 2-[4-[3-(6-tert-butylquinolin-8-yl)-5-(trifluoromethyl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2[c-]c(-c3cccc4oc(-c5ccccc5O)nc34)cc(C(F)(F)F)c2)c2ncccc2c1.[Pt] |
| InChI | InChI=1S/C33H24F3N2O2.Pt/c1-32(2,3)22-15-19-8-7-13-37-29(19)26(18-22)21-14-20(16-23(17-21)33(34,35)36)24-10-6-12-28-30(24)38-31(40-28)25-9-4-5-11-27(25)39;/h4-13,15-18,39H,1-3H3;/q-1; |
| InChIKey | DLBITPAIBJVRLG-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.64 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|