C19H24F3O6S- — CID 177111240
2-[3-(2-cyclohexylpropan-2-yloxy)-4-(trifluoromethyl)benzoyl]oxyethanesulfonate (PubChem CID 177111240) has the molecular formula C19H24F3O6S- and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-[3-(2-cyclohexylpropan-2-yloxy)-4-(trifluoromethyl)benzoyl]oxyethanesulfonate.
| Compound Name | 2-[3-(2-cyclohexylpropan-2-yloxy)-4-(trifluoromethyl)benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111240 |
| Molecular Formula | C19H24F3O6S- |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[3-(2-cyclohexylpropan-2-yloxy)-4-(trifluoromethyl)benzoyl]oxyethanesulfonate |
| SMILES | CC(C)(Oc1cc(C(=O)OCCS(=O)(=O)[O-])ccc1C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C19H25F3O6S/c1-18(2,14-6-4-3-5-7-14)28-16-12-13(8-9-15(16)19(20,21)22)17(23)27-10-11-29(24,25)26/h8-9,12,14H,3-7,10-11H2,1-2H3,(H,24,25,26)/p-1 |
| InChIKey | GBTXDMFWHFGVMH-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|