C28H32F3O8S- — CID 177112022
2-[3-[3-(1-ethenylcyclopentyl)oxy-4-(trifluoromethyl)benzoyl]oxyadamantane-1-carbonyl]oxyethanesulfonate (PubChem CID 177112022) has the molecular formula C28H32F3O8S- and a molecular weight of 585.62 g/mol. Its IUPAC name is 2-[3-[3-(1-ethenylcyclopentyl)oxy-4-(trifluoromethyl)benzoyl]oxyadamantane-1-carbonyl]oxyethanesulfonate.
| Compound Name | 2-[3-[3-(1-ethenylcyclopentyl)oxy-4-(trifluoromethyl)benzoyl]oxyadamantane-1-carbonyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177112022 |
| Molecular Formula | C28H32F3O8S- |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | 2-[3-[3-(1-ethenylcyclopentyl)oxy-4-(trifluoromethyl)benzoyl]oxyadamantane-1-carbonyl]oxyethanesulfonate |
| SMILES | C=CC1(Oc2cc(C(=O)OC34CC5CC(C3)CC(C(=O)OCCS(=O)(=O)[O-])(C5)C4)ccc2C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C28H33F3O8S/c1-2-26(7-3-4-8-26)38-22-12-20(5-6-21(22)28(29,30)31)23(32)39-27-15-18-11-19(16-27)14-25(13-18,17-27)24(33)37-9-10-40(34,35)36/h2,5-6,12,18-19H,1,3-4,7-11,13-17H2,(H,34,35,36)/p-1 |
| InChIKey | HRWNUCKLOOQRFD-UHFFFAOYSA-M |
| XLogP | 5.17 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|