C45H26N4O2 — CID 177113600
1,2,3,4-tetradeuterio-9-[4,6-di(dibenzofuran-1-yl)-1,3,5-triazin-2-yl]-5-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 177113600) has the molecular formula C45H26N4O2 and a molecular weight of 663.78 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-9-[4,6-di(dibenzofuran-1-yl)-1,3,5-triazin-2-yl]-5-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-9-[4,6-di(dibenzofuran-1-yl)-1,3,5-triazin-2-yl]-5-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 177113600 |
| Molecular Formula | C45H26N4O2 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | 1,2,3,4-tetradeuterio-9-[4,6-di(dibenzofuran-1-yl)-1,3,5-triazin-2-yl]-5-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2c2c([2H])c([2H])c([2H])c([2H])c2n3-c2nc(-c3cccc4oc5ccccc5c34)nc(-c3cccc4oc5ccccc5c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H26N4O2/c1-2-13-27(14-3-1)28-18-10-22-35-40(28)29-15-4-7-21-34(29)49(35)45-47-43(32-19-11-25-38-41(32)30-16-5-8-23-36(30)50-38)46-44(48-45)33-20-12-26-39-42(33)31-17-6-9-24-37(31)51-39/h1-26H/i1D,2D,3D,4D,7D,13D,14D,15D,21D |
| InChIKey | OUGPNRSSDZPNLB-AEBVJFLRSA-N |
| XLogP | 11.77 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |