C55H68N4 — CID 177115052
3,6,8-tris[2,6-di(propan-2-yl)phenyl]-1-(2-propan-2-ylphenyl)-2,4,7,9-tetrahydropyrimido[4,5-g]quinazoline-3,8-diium-2,7-diide (PubChem CID 177115052) has the molecular formula C55H68N4 and a molecular weight of 785.18 g/mol. Its IUPAC name is 3,6,8-tris[2,6-di(propan-2-yl)phenyl]-1-(2-propan-2-ylphenyl)-2,4,7,9-tetrahydropyrimido[4,5-g]quinazoline-3,8-diium-2,7-diide.
| Compound Name | 3,6,8-tris[2,6-di(propan-2-yl)phenyl]-1-(2-propan-2-ylphenyl)-2,4,7,9-tetrahydropyrimido[4,5-g]quinazoline-3,8-diium-2,7-diide |
|---|---|
| PubChem CID | 177115052 |
| Molecular Formula | C55H68N4 |
| Molecular Weight | 785.18 g/mol |
| Exact Mass | 784.54 |
| IUPAC Name | 3,6,8-tris[2,6-di(propan-2-yl)phenyl]-1-(2-propan-2-ylphenyl)-2,4,7,9-tetrahydropyrimido[4,5-g]quinazoline-3,8-diium-2,7-diide |
| SMILES | CC(C)c1ccccc1N1[C-]=[N+](c2c(C(C)C)cccc2C(C)C)Cc2cc3c(cc21)C[N+](c1c(C(C)C)cccc1C(C)C)=[C-]N3c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C55H68N4/c1-34(2)43-20-15-16-27-50(43)58-32-56(53-44(35(3)4)21-17-22-45(53)36(5)6)30-41-29-52-42(28-51(41)58)31-57(54-46(37(7)8)23-18-24-47(54)38(9)10)33-59(52)55-48(39(11)12)25-19-26-49(55)40(13)14/h15-29,34-40H,30-31H2,1-14H3 |
| InChIKey | FBODLMZZQFWFJA-UHFFFAOYSA-N |
| XLogP | 15.35 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.18 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|