C14H8ClF4N5 — CID 177117758
5-chloro-2-[[2-(6-fluoro-3-pyridinyl)-4-(trifluoromethyl)imidazol-1-yl]methyl]pyrimidine (PubChem CID 177117758) has the molecular formula C14H8ClF4N5 and a molecular weight of 357.70 g/mol. Its IUPAC name is 5-chloro-2-[[2-(6-fluoro-3-pyridinyl)-4-(trifluoromethyl)imidazol-1-yl]methyl]pyrimidine.
| Compound Name | 5-chloro-2-[[2-(6-fluoro-3-pyridinyl)-4-(trifluoromethyl)imidazol-1-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 177117758 |
| Molecular Formula | C14H8ClF4N5 |
| Molecular Weight | 357.70 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 5-chloro-2-[[2-(6-fluoro-3-pyridinyl)-4-(trifluoromethyl)imidazol-1-yl]methyl]pyrimidine |
| SMILES | Fc1ccc(-c2nc(C(F)(F)F)cn2Cc2ncc(Cl)cn2)cn1 |
| InChI | InChI=1S/C14H8ClF4N5/c15-9-4-21-12(22-5-9)7-24-6-10(14(17,18)19)23-13(24)8-1-2-11(16)20-3-8/h1-6H,7H2 |
| InChIKey | BJNSIKPLRKJQLF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|