C10H8ClF3N4 — CID 172596791
2-chloro-5-[1-ethyl-4-(trifluoromethyl)imidazol-2-yl]pyrazine (PubChem CID 172596791) has the molecular formula C10H8ClF3N4 and a molecular weight of 276.65 g/mol. Its IUPAC name is 2-chloro-5-[1-ethyl-4-(trifluoromethyl)imidazol-2-yl]pyrazine.
| Compound Name | 2-chloro-5-[1-ethyl-4-(trifluoromethyl)imidazol-2-yl]pyrazine |
|---|---|
| PubChem CID | 172596791 |
| Molecular Formula | C10H8ClF3N4 |
| Molecular Weight | 276.65 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-chloro-5-[1-ethyl-4-(trifluoromethyl)imidazol-2-yl]pyrazine |
| SMILES | CCn1cc(C(F)(F)F)nc1-c1cnc(Cl)cn1 |
| InChI | InChI=1S/C10H8ClF3N4/c1-2-18-5-7(10(12,13)14)17-9(18)6-3-16-8(11)4-15-6/h3-5H,2H2,1H3 |
| InChIKey | BAOJNLWXKZCAJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |