C14H10ClF3N4O2S — CID 153412150
2-(5-chloropyrazin-2-yl)-3-ethoxysulfanyloxy-6-(trifluoromethyl)imidazo[1,2-a]pyridine (PubChem CID 153412150) has the molecular formula C14H10ClF3N4O2S and a molecular weight of 390.77 g/mol. Its IUPAC name is 2-(5-chloropyrazin-2-yl)-3-ethoxysulfanyloxy-6-(trifluoromethyl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(5-chloropyrazin-2-yl)-3-ethoxysulfanyloxy-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 153412150 |
| Molecular Formula | C14H10ClF3N4O2S |
| Molecular Weight | 390.77 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 2-(5-chloropyrazin-2-yl)-3-ethoxysulfanyloxy-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| SMILES | CCOSOc1c(-c2cnc(Cl)cn2)nc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C14H10ClF3N4O2S/c1-2-23-25-24-13-12(9-5-20-10(15)6-19-9)21-11-4-3-8(7-22(11)13)14(16,17)18/h3-7H,2H2,1H3 |
| InChIKey | LBVBKXQZGSTKBX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|