C9H8BrFN2O2S — CID 164816748
6-bromo-3-ethoxysulfanyloxy-2-fluoroimidazo[1,2-a]pyridine (PubChem CID 164816748) has the molecular formula C9H8BrFN2O2S and a molecular weight of 307.14 g/mol. Its IUPAC name is 6-bromo-3-ethoxysulfanyloxy-2-fluoroimidazo[1,2-a]pyridine.
| Compound Name | 6-bromo-3-ethoxysulfanyloxy-2-fluoroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 164816748 |
| Molecular Formula | C9H8BrFN2O2S |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 6-bromo-3-ethoxysulfanyloxy-2-fluoroimidazo[1,2-a]pyridine |
| SMILES | CCOSOc1c(F)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C9H8BrFN2O2S/c1-2-14-16-15-9-8(11)12-7-4-3-6(10)5-13(7)9/h3-5H,2H2,1H3 |
| InChIKey | TZJGHJKNRHALOV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|