C18H16F3N5O3S — CID 163790798
2-[3-ethoxysulfanyloxy-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,5-dimethylpyrazolo[3,4-b]pyridin-3-one (PubChem CID 163790798) has the molecular formula C18H16F3N5O3S and a molecular weight of 439.42 g/mol. Its IUPAC name is 2-[3-ethoxysulfanyloxy-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,5-dimethylpyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 2-[3-ethoxysulfanyloxy-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,5-dimethylpyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 163790798 |
| Molecular Formula | C18H16F3N5O3S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-[3-ethoxysulfanyloxy-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,5-dimethylpyrazolo[3,4-b]pyridin-3-one |
| SMILES | CCOSOc1c(-n2c(=O)c3cc(C)cnc3n2C)nc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C18H16F3N5O3S/c1-4-28-30-29-17-15(23-13-6-5-11(9-25(13)17)18(19,20)21)26-16(27)12-7-10(2)8-22-14(12)24(26)3/h5-9H,4H2,1-3H3 |
| InChIKey | MWNWMXXRMSBYHD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|